The document explains how to derive the compound angle formula for sin(A+B) using a diagram with two lines forming angles A and B. It shows that the angles marked (90-A) are equal, as are the angles equal to A. Using the relationships between trigonometric functions of equal angles, it rewrites sin(A+B) in terms of the sines and cosines of A and B, arriving at the formula sin(A+B)=BsinAcos+BcosAsin.